C11H20F3NO5S — CID 87059944
4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;2,2,2-trifluoroacetate (PubChem CID 87059944) has the molecular formula C11H20F3NO5S and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;2,2,2-trifluoroacetate.
| Compound Name | 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87059944 |
| Molecular Formula | C11H20F3NO5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;2,2,2-trifluoroacetate |
| SMILES | C[NH+]1CCC(CCCCS(=O)(=O)O)C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H19NO3S.C2HF3O2/c1-10-6-5-9(8-10)4-2-3-7-14(11,12)13;3-2(4,5)1(6)7/h9H,2-8H2,1H3,(H,11,12,13);(H,6,7) |
| InChIKey | CWTQOGOHLLEOJT-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|