About tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid
tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid (PubChem CID 87059960) has the molecular formula C16H35F3NO6S2+
and a molecular weight of 458.59 g/mol. Its IUPAC name is tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid |
| PubChem CID | 87059960 |
| Molecular Formula | C16H35F3NO6S2+ |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCS(=O)(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H33NO3S.CHF3O3S/c1-4-7-11-16(12-8-5-2,13-9-6-3)14-10-15-20(17,18)19;2-1(3,4)8(5,6)7/h4-15H2,1-3H3;(H,5,6,7)/p+1 |
| InChIKey | VQBJXJRHNOVEBO-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid?
The IUPAC name of tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid (CID 87059960) is tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid.
What is the SMILES notation for tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid?
The canonical SMILES for tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid is CCCC[N+](CCCC)(CCCC)CCCS(=O)(=O)O.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid?
The InChIKey is VQBJXJRHNOVEBO-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H33NO3S.CHF3O3S/c1-4-7-11-16(12-8-5-2,13-9-6-3)14-10-15-20(17,18)19;2-1(3,4)8(5,6)7/h4-15H2,1-3H3;(H,5,6,7)/p+1.
What are the key properties of tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid?
tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid has a molecular weight of 458.59 g/mol, XLogP of 3.88, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(3-sulfopropyl)azanium;trifluoromethanesulfonic acid is sourced from PubChem (CID 87059960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).