About 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate
4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate (PubChem CID 87059974) has the molecular formula C10H20F3NO6S2
and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate |
| PubChem CID | 87059974 |
| Molecular Formula | C10H20F3NO6S2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate |
| SMILES | C[NH+]1CCC(CCCCS(=O)(=O)O)C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H19NO3S.CHF3O3S/c1-10-6-5-9(8-10)4-2-3-7-14(11,12)13;2-1(3,4)8(5,6)7/h9H,2-8H2,1H3,(H,11,12,13);(H,5,6,7) |
| InChIKey | ZBGOXRHULIPOPA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate?
The IUPAC name of 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate (CID 87059974) is 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate.
What is the SMILES notation for 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate?
The canonical SMILES for 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate is C[NH+]1CCC(CCCCS(=O)(=O)O)C1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate?
The InChIKey is ZBGOXRHULIPOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S.CHF3O3S/c1-10-6-5-9(8-10)4-2-3-7-14(11,12)13;2-1(3,4)8(5,6)7/h9H,2-8H2,1H3,(H,11,12,13);(H,5,6,7).
What are the key properties of 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate?
4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate has a molecular weight of 371.40 g/mol, XLogP of -0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylpyrrolidin-1-ium-3-yl)butane-1-sulfonic acid;trifluoromethanesulfonate is sourced from PubChem (CID 87059974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).