C11H14F3N5O7S — CID 87060048
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;trifluoromethanesulfonic acid (PubChem CID 87060048) has the molecular formula C11H14F3N5O7S and a molecular weight of 417.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;trifluoromethanesulfonic acid.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87060048 |
| Molecular Formula | C11H14F3N5O7S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;trifluoromethanesulfonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H13N5O4.CHF3O3S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;2-1(3,4)8(5,6)7/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);(H,5,6,7)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | QMMYKDUNFCCGTB-MCDZGGTQSA-N |
| XLogP | -1.59 |
| TPSA | 193.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|