About tert-butyl prop-2-enoate;prop-2-enoic acid
tert-butyl prop-2-enoate;prop-2-enoic acid (PubChem CID 87060212) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;prop-2-enoic acid |
| PubChem CID | 87060212 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | tert-butyl prop-2-enoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H12O2.C3H4O2/c1-5-6(8)9-7(2,3)4;1-2-3(4)5/h5H,1H2,2-4H3;2H,1H2,(H,4,5) |
| InChIKey | PPRAVOKAIZTTHZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;prop-2-enoic acid?
The IUPAC name of tert-butyl prop-2-enoate;prop-2-enoic acid (CID 87060212) is tert-butyl prop-2-enoate;prop-2-enoic acid.
What is the SMILES notation for tert-butyl prop-2-enoate;prop-2-enoic acid?
The canonical SMILES for tert-butyl prop-2-enoate;prop-2-enoic acid is C=CC(=O)O.C=CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl prop-2-enoate;prop-2-enoic acid?
The InChIKey is PPRAVOKAIZTTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C3H4O2/c1-5-6(8)9-7(2,3)4;1-2-3(4)5/h5H,1H2,2-4H3;2H,1H2,(H,4,5).
What are the key properties of tert-butyl prop-2-enoate;prop-2-enoic acid?
tert-butyl prop-2-enoate;prop-2-enoic acid has a molecular weight of 200.23 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;prop-2-enoic acid is sourced from PubChem (CID 87060212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).