C38H29N5S4 — CID 87060368
2-[[4-butyl-5-[10-[3-butyl-5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]propanedinitrile (PubChem CID 87060368) has the molecular formula C38H29N5S4 and a molecular weight of 683.95 g/mol. Its IUPAC name is 2-[[4-butyl-5-[10-[3-butyl-5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-butyl-5-[10-[3-butyl-5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 87060368 |
| Molecular Formula | C38H29N5S4 |
| Molecular Weight | 683.95 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | 2-[[4-butyl-5-[10-[3-butyl-5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]propanedinitrile |
| SMILES | CCCCc1cc(C=C(C#N)C#N)sc1-c1cc2c(s1)c1sc(-c3sc(C=C(C#N)C#N)cc3CCCC)cc1n2-c1ccccc1 |
| InChI | InChI=1S/C38H29N5S4/c1-3-5-10-26-16-29(14-24(20-39)21-40)44-35(26)33-18-31-37(46-33)38-32(43(31)28-12-8-7-9-13-28)19-34(47-38)36-27(11-6-4-2)17-30(45-36)15-25(22-41)23-42/h7-9,12-19H,3-6,10-11H2,1-2H3 |
| InChIKey | PXDQGRNPMGRPMJ-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.95 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|