About 2-prop-2-enyl-1,3-thiazole-4-thione
2-prop-2-enyl-1,3-thiazole-4-thione (PubChem CID 87060887) has the molecular formula C6H7NS2
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3-thiazole-4-thione.
Molecular Properties
| Compound Name | 2-prop-2-enyl-1,3-thiazole-4-thione |
| PubChem CID | 87060887 |
| Molecular Formula | C6H7NS2 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.00 |
| IUPAC Name | 2-prop-2-enyl-1,3-thiazole-4-thione |
| SMILES | C=CCC1=NC(=S)CS1 |
| InChI | InChI=1S/C6H7NS2/c1-2-3-6-7-5(8)4-9-6/h2H,1,3-4H2 |
| InChIKey | RDGJWNQSCKTWFZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enyl-1,3-thiazole-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enyl-1,3-thiazole-4-thione?
The IUPAC name of 2-prop-2-enyl-1,3-thiazole-4-thione (CID 87060887) is 2-prop-2-enyl-1,3-thiazole-4-thione.
What is the SMILES notation for 2-prop-2-enyl-1,3-thiazole-4-thione?
The canonical SMILES for 2-prop-2-enyl-1,3-thiazole-4-thione is C=CCC1=NC(=S)CS1.
What is the InChIKey of 2-prop-2-enyl-1,3-thiazole-4-thione?
The InChIKey is RDGJWNQSCKTWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS2/c1-2-3-6-7-5(8)4-9-6/h2H,1,3-4H2.
What are the key properties of 2-prop-2-enyl-1,3-thiazole-4-thione?
2-prop-2-enyl-1,3-thiazole-4-thione has a molecular weight of 157.26 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enyl-1,3-thiazole-4-thione is sourced from PubChem (CID 87060887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).