About bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+)
bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) (PubChem CID 87061345) has the molecular formula C24H40O8Sn
and a molecular weight of 575.29 g/mol. Its IUPAC name is bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+).
Molecular Properties
| Compound Name | bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) |
| PubChem CID | 87061345 |
| Molecular Formula | C24H40O8Sn |
| Molecular Weight | 575.29 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) |
| SMILES | CCCCOC(=O)/C=C\C(=O)[O-].CCCCOC(=O)/C=C\C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C8H12O4.2C4H9.Sn/c2*1-2-3-6-12-8(11)5-4-7(9)10;2*1-3-4-2;/h2*4-5H,2-3,6H2,1H3,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*5-4-;;; |
| InChIKey | OZDOQMMXEACZAA-NRFIWDAESA-L |
| XLogP | 2.40 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 575.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+)?
The IUPAC name of bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) (CID 87061345) is bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+).
What is the SMILES notation for bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+)?
The canonical SMILES for bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) is CCCCOC(=O)/C=C\C(=O)[O-].CCCCOC(=O)/C=C\C(=O)[O-].CCCC[Sn+2]CCCC.
What is the InChIKey of bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+)?
The InChIKey is OZDOQMMXEACZAA-NRFIWDAESA-L. The full InChI is InChI=1S/2C8H12O4.2C4H9.Sn/c2*1-2-3-6-12-8(11)5-4-7(9)10;2*1-3-4-2;/h2*4-5H,2-3,6H2,1H3,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*5-4-;;;.
What are the key properties of bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+)?
bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) has a molecular weight of 575.29 g/mol, XLogP of 2.40, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-4-butoxy-4-oxobut-2-enoate);dibutyltin(2+) is sourced from PubChem (CID 87061345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).