About 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide
3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide (PubChem CID 87061490) has the molecular formula C17H19NO4S
and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide.
Molecular Properties
| Compound Name | 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide |
| PubChem CID | 87061490 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide |
| SMILES | Cc1c2ccccc2[n+](CCCS(=O)(=O)O)c2ccccc12.[OH-] |
| InChI | InChI=1S/C17H17NO3S.H2O/c1-13-14-7-2-4-9-16(14)18(11-6-12-22(19,20)21)17-10-5-3-8-15(13)17;/h2-5,7-10H,6,11-12H2,1H3;1H2 |
| InChIKey | KMEVYCORNQPGIZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide?
The IUPAC name of 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide (CID 87061490) is 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide.
What is the SMILES notation for 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide?
The canonical SMILES for 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide is Cc1c2ccccc2[n+](CCCS(=O)(=O)O)c2ccccc12.[OH-].
What is the InChIKey of 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide?
The InChIKey is KMEVYCORNQPGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3S.H2O/c1-13-14-7-2-4-9-16(14)18(11-6-12-22(19,20)21)17-10-5-3-8-15(13)17;/h2-5,7-10H,6,11-12H2,1H3;1H2.
What are the key properties of 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide?
3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide has a molecular weight of 333.41 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9-methylacridin-10-ium-10-yl)propane-1-sulfonic acid hydroxide is sourced from PubChem (CID 87061490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).