C15H16N3O4S- — CID 8706291
(E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(5-piperidin-1-ylfuran-2-yl)prop-2-enoate (PubChem CID 8706291) has the molecular formula C15H16N3O4S- and a molecular weight of 334.38 g/mol. Its IUPAC name is (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(5-piperidin-1-ylfuran-2-yl)prop-2-enoate.
| Compound Name | (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(5-piperidin-1-ylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8706291 |
| Molecular Formula | C15H16N3O4S- |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(5-piperidin-1-ylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1nnc(S/C(=C/c2ccc(N3CCCCC3)o2)C(=O)[O-])o1 |
| InChI | InChI=1S/C15H17N3O4S/c1-10-16-17-15(21-10)23-12(14(19)20)9-11-5-6-13(22-11)18-7-3-2-4-8-18/h5-6,9H,2-4,7-8H2,1H3,(H,19,20)/p-1/b12-9+ |
| InChIKey | MLGNZQZKCSLBQK-FMIVXFBMSA-M |
| XLogP | 1.84 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|