C30H16F6N2O4 — CID 87063251
5,11-bis[[4-(trifluoromethyl)phenyl]methyl]-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone (PubChem CID 87063251) has the molecular formula C30H16F6N2O4 and a molecular weight of 582.46 g/mol. Its IUPAC name is 5,11-bis[[4-(trifluoromethyl)phenyl]methyl]-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone.
| Compound Name | 5,11-bis[[4-(trifluoromethyl)phenyl]methyl]-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 87063251 |
| Molecular Formula | C30H16F6N2O4 |
| Molecular Weight | 582.46 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 5,11-bis[[4-(trifluoromethyl)phenyl]methyl]-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
| SMILES | O=c1c2ccc(c(=O)n1Cc1ccc(C(F)(F)F)cc1)c1c3ccc(c(=O)n(Cc4ccc(C(F)(F)F)cc4)c3=O)c21 |
| InChI | InChI=1S/C30H16F6N2O4/c31-29(32,33)17-5-1-15(2-6-17)13-37-25(39)19-9-10-20(26(37)40)24-22-12-11-21(23(19)24)27(41)38(28(22)42)14-16-3-7-18(8-4-16)30(34,35)36/h1-12H,13-14H2 |
| InChIKey | YPKCBCTUYPBKFM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |