C28H29F3N6O7S — CID 87063372
4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid (PubChem CID 87063372) has the molecular formula C28H29F3N6O7S and a molecular weight of 650.64 g/mol. Its IUPAC name is 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87063372 |
| Molecular Formula | C28H29F3N6O7S |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid |
| SMILES | C[C@](O)(CN1CCN(C(=O)O)CC1CC=Cc1ccc(C(F)(F)F)cc1)Cn1cc([N+](=O)[O-])nc1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29F3N6O7S/c1-27(40,18-35-16-24(37(43)44)32-25(35)45-23-11-9-21(10-12-23)36(41)42)17-34-14-13-33(26(38)39)15-22(34)4-2-3-19-5-7-20(8-6-19)28(29,30)31/h2-3,5-12,16,22,40H,4,13-15,17-18H2,1H3,(H,38,39)/t22?,27-/m0/s1 |
| InChIKey | UCYDHZCWERBRGD-ZUILJJEPSA-N |
| XLogP | 5.39 |
| TPSA | 168.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|