C28H29F3N6O7S — CID 87063376
4-[2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-2-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 87063376) has the molecular formula C28H29F3N6O7S and a molecular weight of 650.64 g/mol. Its IUPAC name is 4-[2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-2-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-2-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87063376 |
| Molecular Formula | C28H29F3N6O7S |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 4-[2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfanylimidazol-1-yl]propyl]-2-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
| SMILES | C=CCC1C(c2ccc(C(F)(F)F)cc2)N(CC(C)(O)Cn2cc([N+](=O)[O-])nc2Sc2ccc([N+](=O)[O-])cc2)CCN1C(=O)O |
| InChI | InChI=1S/C28H29F3N6O7S/c1-3-4-22-24(18-5-7-19(8-6-18)28(29,30)31)33(13-14-35(22)26(38)39)16-27(2,40)17-34-15-23(37(43)44)32-25(34)45-21-11-9-20(10-12-21)36(41)42/h3,5-12,15,22,24,40H,1,4,13-14,16-17H2,2H3,(H,38,39) |
| InChIKey | YXRGWAYLNAYUHP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 168.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|