C28H29F3N6O9S — CID 87063466
4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfonylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid (PubChem CID 87063466) has the molecular formula C28H29F3N6O9S and a molecular weight of 682.63 g/mol. Its IUPAC name is 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfonylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfonylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87063466 |
| Molecular Formula | C28H29F3N6O9S |
| Molecular Weight | 682.63 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(4-nitrophenyl)sulfonylimidazol-1-yl]propyl]-3-[3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazine-1-carboxylic acid |
| SMILES | C[C@](O)(CN1CCN(C(=O)O)CC1CC=Cc1ccc(C(F)(F)F)cc1)Cn1cc([N+](=O)[O-])nc1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29F3N6O9S/c1-27(40,18-35-16-24(37(43)44)32-25(35)47(45,46)23-11-9-21(10-12-23)36(41)42)17-34-14-13-33(26(38)39)15-22(34)4-2-3-19-5-7-20(8-6-19)28(29,30)31/h2-3,5-12,16,22,40H,4,13-15,17-18H2,1H3,(H,38,39)/t22?,27-/m0/s1 |
| InChIKey | KPNVOCDHLFXMBK-ZUILJJEPSA-N |
| XLogP | 4.07 |
| TPSA | 202.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|