About 7-amino-3,4,5-trifluorochromen-2-one
7-amino-3,4,5-trifluorochromen-2-one (PubChem CID 87063496) has the molecular formula C9H4F3NO2
and a molecular weight of 215.13 g/mol. Its IUPAC name is 7-amino-3,4,5-trifluorochromen-2-one.
Molecular Properties
| Compound Name | 7-amino-3,4,5-trifluorochromen-2-one |
| PubChem CID | 87063496 |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 7-amino-3,4,5-trifluorochromen-2-one |
| SMILES | Nc1cc(F)c2c(F)c(F)c(=O)oc2c1 |
| InChI | InChI=1S/C9H4F3NO2/c10-4-1-3(13)2-5-6(4)7(11)8(12)9(14)15-5/h1-2H,13H2 |
| InChIKey | CKWSMOULNFRJFG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-3,4,5-trifluorochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-3,4,5-trifluorochromen-2-one?
The IUPAC name of 7-amino-3,4,5-trifluorochromen-2-one (CID 87063496) is 7-amino-3,4,5-trifluorochromen-2-one.
What is the SMILES notation for 7-amino-3,4,5-trifluorochromen-2-one?
The canonical SMILES for 7-amino-3,4,5-trifluorochromen-2-one is Nc1cc(F)c2c(F)c(F)c(=O)oc2c1.
What is the InChIKey of 7-amino-3,4,5-trifluorochromen-2-one?
The InChIKey is CKWSMOULNFRJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3NO2/c10-4-1-3(13)2-5-6(4)7(11)8(12)9(14)15-5/h1-2H,13H2.
What are the key properties of 7-amino-3,4,5-trifluorochromen-2-one?
7-amino-3,4,5-trifluorochromen-2-one has a molecular weight of 215.13 g/mol, XLogP of 1.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-3,4,5-trifluorochromen-2-one is sourced from PubChem (CID 87063496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).