About 2-ethyloxirane;furan-2,5-dione;propan-1-ol
2-ethyloxirane;furan-2,5-dione;propan-1-ol (PubChem CID 87063854) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-ethyloxirane;furan-2,5-dione;propan-1-ol.
Molecular Properties
| Compound Name | 2-ethyloxirane;furan-2,5-dione;propan-1-ol |
| PubChem CID | 87063854 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-ethyloxirane;furan-2,5-dione;propan-1-ol |
| SMILES | CCC1CO1.CCCO.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.C4H8O.C3H8O/c5-3-1-2-4(6)7-3;1-2-4-3-5-4;1-2-3-4/h1-2H;4H,2-3H2,1H3;4H,2-3H2,1H3 |
| InChIKey | PPHSJKCPQCGNFG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyloxirane;furan-2,5-dione;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyloxirane;furan-2,5-dione;propan-1-ol?
The IUPAC name of 2-ethyloxirane;furan-2,5-dione;propan-1-ol (CID 87063854) is 2-ethyloxirane;furan-2,5-dione;propan-1-ol.
What is the SMILES notation for 2-ethyloxirane;furan-2,5-dione;propan-1-ol?
The canonical SMILES for 2-ethyloxirane;furan-2,5-dione;propan-1-ol is CCC1CO1.CCCO.O=C1C=CC(=O)O1.
What is the InChIKey of 2-ethyloxirane;furan-2,5-dione;propan-1-ol?
The InChIKey is PPHSJKCPQCGNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C4H8O.C3H8O/c5-3-1-2-4(6)7-3;1-2-4-3-5-4;1-2-3-4/h1-2H;4H,2-3H2,1H3;4H,2-3H2,1H3.
What are the key properties of 2-ethyloxirane;furan-2,5-dione;propan-1-ol?
2-ethyloxirane;furan-2,5-dione;propan-1-ol has a molecular weight of 230.26 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyloxirane;furan-2,5-dione;propan-1-ol is sourced from PubChem (CID 87063854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).