C24H34F3NO8SSi — CID 87063856
1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 87063856) has the molecular formula C24H34F3NO8SSi and a molecular weight of 581.68 g/mol. Its IUPAC name is 1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 87063856 |
| Molecular Formula | C24H34F3NO8SSi |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 1-O-benzyl 5-O-ethyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CC(CO[Si](C)(C)C(C)(C)C)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H34F3NO8SSi/c1-7-33-21(29)19-14-28(22(30)34-15-17-11-9-8-10-12-17)18(16-35-38(5,6)23(2,3)4)13-20(19)36-37(31,32)24(25,26)27/h8-12,18H,7,13-16H2,1-6H3 |
| InChIKey | JSZDXIBAJZUUNZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|