About morpholine;(phenyldisulfanyl)benzene
morpholine;(phenyldisulfanyl)benzene (PubChem CID 87064423) has the molecular formula C16H19NOS2
and a molecular weight of 305.47 g/mol. Its IUPAC name is morpholine;(phenyldisulfanyl)benzene.
Molecular Properties
| Compound Name | morpholine;(phenyldisulfanyl)benzene |
| PubChem CID | 87064423 |
| Molecular Formula | C16H19NOS2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | morpholine;(phenyldisulfanyl)benzene |
| SMILES | C1COCCN1.c1ccc(SSc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S2.C4H9NO/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-3-6-4-2-5-1/h1-10H;5H,1-4H2 |
| InChIKey | GJLGEQGFVJRQTC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze morpholine;(phenyldisulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;(phenyldisulfanyl)benzene?
The IUPAC name of morpholine;(phenyldisulfanyl)benzene (CID 87064423) is morpholine;(phenyldisulfanyl)benzene.
What is the SMILES notation for morpholine;(phenyldisulfanyl)benzene?
The canonical SMILES for morpholine;(phenyldisulfanyl)benzene is C1COCCN1.c1ccc(SSc2ccccc2)cc1.
What is the InChIKey of morpholine;(phenyldisulfanyl)benzene?
The InChIKey is GJLGEQGFVJRQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S2.C4H9NO/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-3-6-4-2-5-1/h1-10H;5H,1-4H2.
What are the key properties of morpholine;(phenyldisulfanyl)benzene?
morpholine;(phenyldisulfanyl)benzene has a molecular weight of 305.47 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;(phenyldisulfanyl)benzene is sourced from PubChem (CID 87064423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).