C20H24N4 — CID 87064982
(10Z,14Z,19Z)-1,2,3,4,5,6,7,8,9,21,22,23-dodecahydroporphyrin (PubChem CID 87064982) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is (10Z,14Z,19Z)-1,2,3,4,5,6,7,8,9,21,22,23-dodecahydroporphyrin.
| Compound Name | (10Z,14Z,19Z)-1,2,3,4,5,6,7,8,9,21,22,23-dodecahydroporphyrin |
|---|---|
| PubChem CID | 87064982 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (10Z,14Z,19Z)-1,2,3,4,5,6,7,8,9,21,22,23-dodecahydroporphyrin |
| SMILES | C1=C/C2=C/C3CCC(CC4CCC(/C=c5/cc/c([nH]5)=C/C1=N2)N4)N3 |
| InChI | InChI=1S/C20H24N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-4,9-11,16,18-21,23-24H,5-8,12H2/b13-9-,14-10-,17-11- |
| InChIKey | YNQSADURTQDKPO-VZPOTTSCSA-N |
| XLogP | 1.12 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |