C23H41N3O3 — CID 87065158
N-[1-[[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1,4-dimethylpiperidine-2-carboxamide (PubChem CID 87065158) has the molecular formula C23H41N3O3 and a molecular weight of 407.60 g/mol. Its IUPAC name is N-[1-[[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1,4-dimethylpiperidine-2-carboxamide.
| Compound Name | N-[1-[[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1,4-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 87065158 |
| Molecular Formula | C23H41N3O3 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | N-[1-[[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1,4-dimethylpiperidine-2-carboxamide |
| SMILES | C/C(C=O)=C\[C@H](C(C)C)N(C)C(=O)C(NC(=O)C1CC(C)CCN1C)C(C)(C)C |
| InChI | InChI=1S/C23H41N3O3/c1-15(2)18(13-17(4)14-27)26(9)22(29)20(23(5,6)7)24-21(28)19-12-16(3)10-11-25(19)8/h13-16,18-20H,10-12H2,1-9H3,(H,24,28)/b17-13+/t16?,18-,19?,20?/m1/s1 |
| InChIKey | AQYBZYUGYKZWIB-GRJATFGZSA-N |
| XLogP | 2.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|