C27H28F4N8OS — CID 87065257
1-[4-[4-amino-7-[[4-(2,2,2-trifluoroethylsulfanyl)piperazin-1-yl]methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 87065257) has the molecular formula C27H28F4N8OS and a molecular weight of 588.64 g/mol. Its IUPAC name is 1-[4-[4-amino-7-[[4-(2,2,2-trifluoroethylsulfanyl)piperazin-1-yl]methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[4-[4-amino-7-[[4-(2,2,2-trifluoroethylsulfanyl)piperazin-1-yl]methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 87065257 |
| Molecular Formula | C27H28F4N8OS |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 1-[4-[4-amino-7-[[4-(2,2,2-trifluoroethylsulfanyl)piperazin-1-yl]methyl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cc(CN4CCN(SCC(F)(F)F)CC4)n4ncnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C27H28F4N8OS/c1-17-2-7-22(28)23(12-17)36-26(40)35-19-5-3-18(4-6-19)21-13-20(39-24(21)25(32)33-16-34-39)14-37-8-10-38(11-9-37)41-15-27(29,30)31/h2-7,12-13,16H,8-11,14-15H2,1H3,(H2,32,33,34)(H2,35,36,40) |
| InChIKey | MXWSGARUBRHERJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|