C24H21F7O2S — CID 87065413
[3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate (PubChem CID 87065413) has the molecular formula C24H21F7O2S and a molecular weight of 506.48 g/mol. Its IUPAC name is [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate.
| Compound Name | [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate |
|---|---|
| PubChem CID | 87065413 |
| Molecular Formula | C24H21F7O2S |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate |
| SMILES | Cc1cc(C)c(-c2cc(C)c(C(=O)Oc3cc(F)c(S(F)(F)(F)(F)F)c(F)c3)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C24H21F7O2S/c1-12-6-13(2)21(14(3)7-12)17-8-15(4)22(16(5)9-17)24(32)33-18-10-19(25)23(20(26)11-18)34(27,28,29,30)31/h6-11H,1-5H3 |
| InChIKey | BMIPYTUOKLKDMD-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|