C24H23F5O2S — CID 87065415
[4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate (PubChem CID 87065415) has the molecular formula C24H23F5O2S and a molecular weight of 470.50 g/mol. Its IUPAC name is [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate.
| Compound Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate |
|---|---|
| PubChem CID | 87065415 |
| Molecular Formula | C24H23F5O2S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate |
| SMILES | Cc1cc(C)c(-c2cc(C)c(C(=O)Oc3ccc(S(F)(F)(F)(F)F)cc3)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C24H23F5O2S/c1-14-10-15(2)22(16(3)11-14)19-12-17(4)23(18(5)13-19)24(30)31-20-6-8-21(9-7-20)32(25,26,27,28)29/h6-13H,1-5H3 |
| InChIKey | JUKOXEGJLJFLGE-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|