C23H18F8O2S — CID 87065417
[3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(2-fluoro-4,6-dimethylphenyl)-2,6-dimethylbenzoate (PubChem CID 87065417) has the molecular formula C23H18F8O2S and a molecular weight of 510.45 g/mol. Its IUPAC name is [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(2-fluoro-4,6-dimethylphenyl)-2,6-dimethylbenzoate.
| Compound Name | [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(2-fluoro-4,6-dimethylphenyl)-2,6-dimethylbenzoate |
|---|---|
| PubChem CID | 87065417 |
| Molecular Formula | C23H18F8O2S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | [3,5-difluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-(2-fluoro-4,6-dimethylphenyl)-2,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(-c2cc(C)c(C(=O)Oc3cc(F)c(S(F)(F)(F)(F)F)c(F)c3)c(C)c2)c(F)c1 |
| InChI | InChI=1S/C23H18F8O2S/c1-11-5-12(2)21(17(24)6-11)15-7-13(3)20(14(4)8-15)23(32)33-16-9-18(25)22(19(26)10-16)34(27,28,29,30)31/h5-10H,1-4H3 |
| InChIKey | UUTJVKUGBVVTAJ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|