C24H22F6O2S — CID 87065422
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate (PubChem CID 87065422) has the molecular formula C24H22F6O2S and a molecular weight of 488.49 g/mol. Its IUPAC name is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate.
| Compound Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate |
|---|---|
| PubChem CID | 87065422 |
| Molecular Formula | C24H22F6O2S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 2,6-dimethyl-4-(2,4,6-trimethylphenyl)benzoate |
| SMILES | Cc1cc(C)c(-c2cc(C)c(C(=O)Oc3ccc(S(F)(F)(F)(F)F)c(F)c3)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C24H22F6O2S/c1-13-8-14(2)22(15(3)9-13)18-10-16(4)23(17(5)11-18)24(31)32-19-6-7-21(20(25)12-19)33(26,27,28,29)30/h6-12H,1-5H3 |
| InChIKey | YQPRUCDVJIFFLP-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|