C13H20F6O — CID 87065546
(Z)-1,1,1-trifluoro-4,9-dimethyl-2-(trifluoromethyl)dec-6-en-2-ol (PubChem CID 87065546) has the molecular formula C13H20F6O and a molecular weight of 306.29 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4,9-dimethyl-2-(trifluoromethyl)dec-6-en-2-ol.
| Compound Name | (Z)-1,1,1-trifluoro-4,9-dimethyl-2-(trifluoromethyl)dec-6-en-2-ol |
|---|---|
| PubChem CID | 87065546 |
| Molecular Formula | C13H20F6O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4,9-dimethyl-2-(trifluoromethyl)dec-6-en-2-ol |
| SMILES | CC(C)C/C=C\CC(C)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H20F6O/c1-9(2)6-4-5-7-10(3)8-11(20,12(14,15)16)13(17,18)19/h4-5,9-10,20H,6-8H2,1-3H3/b5-4- |
| InChIKey | VGKRZCYLGJJJPV-PLNGDYQASA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|