About 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane
4-(2-ethoxyethoxy)-2,6,8-trimethylnonane (PubChem CID 87065827) has the molecular formula C16H34O2
and a molecular weight of 258.45 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane.
Molecular Properties
| Compound Name | 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane |
| PubChem CID | 87065827 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane |
| SMILES | CCOCCOC(CC(C)C)CC(C)CC(C)C |
| InChI | InChI=1S/C16H34O2/c1-7-17-8-9-18-16(11-14(4)5)12-15(6)10-13(2)3/h13-16H,7-12H2,1-6H3 |
| InChIKey | PPFQLGQRUFRNQS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane?
The IUPAC name of 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane (CID 87065827) is 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane.
What is the SMILES notation for 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane?
The canonical SMILES for 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane is CCOCCOC(CC(C)C)CC(C)CC(C)C.
What is the InChIKey of 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane?
The InChIKey is PPFQLGQRUFRNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2/c1-7-17-8-9-18-16(11-14(4)5)12-15(6)10-13(2)3/h13-16H,7-12H2,1-6H3.
What are the key properties of 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane?
4-(2-ethoxyethoxy)-2,6,8-trimethylnonane has a molecular weight of 258.45 g/mol, XLogP of 4.53, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethoxyethoxy)-2,6,8-trimethylnonane is sourced from PubChem (CID 87065827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).