About [4-(hydroxymethyl)cyclohexyl]methanol;oxirane
[4-(hydroxymethyl)cyclohexyl]methanol;oxirane (PubChem CID 87065906) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methanol;oxirane.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)cyclohexyl]methanol;oxirane |
| PubChem CID | 87065906 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [4-(hydroxymethyl)cyclohexyl]methanol;oxirane |
| SMILES | C1CO1.OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C8H16O2.C2H4O/c9-5-7-1-2-8(6-10)4-3-7;1-2-3-1/h7-10H,1-6H2;1-2H2 |
| InChIKey | UCHGOTBQZQAGBC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroxymethyl)cyclohexyl]methanol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)cyclohexyl]methanol;oxirane?
The IUPAC name of [4-(hydroxymethyl)cyclohexyl]methanol;oxirane (CID 87065906) is [4-(hydroxymethyl)cyclohexyl]methanol;oxirane.
What is the SMILES notation for [4-(hydroxymethyl)cyclohexyl]methanol;oxirane?
The canonical SMILES for [4-(hydroxymethyl)cyclohexyl]methanol;oxirane is C1CO1.OCC1CCC(CO)CC1.
What is the InChIKey of [4-(hydroxymethyl)cyclohexyl]methanol;oxirane?
The InChIKey is UCHGOTBQZQAGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C2H4O/c9-5-7-1-2-8(6-10)4-3-7;1-2-3-1/h7-10H,1-6H2;1-2H2.
What are the key properties of [4-(hydroxymethyl)cyclohexyl]methanol;oxirane?
[4-(hydroxymethyl)cyclohexyl]methanol;oxirane has a molecular weight of 188.27 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)cyclohexyl]methanol;oxirane is sourced from PubChem (CID 87065906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).