About (E)-6-(2,4,6-trifluorophenyl)hex-5-enal
(E)-6-(2,4,6-trifluorophenyl)hex-5-enal (PubChem CID 87065924) has the molecular formula C12H11F3O
and a molecular weight of 228.21 g/mol. Its IUPAC name is (E)-6-(2,4,6-trifluorophenyl)hex-5-enal.
Molecular Properties
| Compound Name | (E)-6-(2,4,6-trifluorophenyl)hex-5-enal |
| PubChem CID | 87065924 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (E)-6-(2,4,6-trifluorophenyl)hex-5-enal |
| SMILES | O=CCCC/C=C/c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H11F3O/c13-9-7-11(14)10(12(15)8-9)5-3-1-2-4-6-16/h3,5-8H,1-2,4H2/b5-3+ |
| InChIKey | CGHIDYMDGRVWNI-HWKANZROSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-(2,4,6-trifluorophenyl)hex-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-(2,4,6-trifluorophenyl)hex-5-enal?
The IUPAC name of (E)-6-(2,4,6-trifluorophenyl)hex-5-enal (CID 87065924) is (E)-6-(2,4,6-trifluorophenyl)hex-5-enal.
What is the SMILES notation for (E)-6-(2,4,6-trifluorophenyl)hex-5-enal?
The canonical SMILES for (E)-6-(2,4,6-trifluorophenyl)hex-5-enal is O=CCCC/C=C/c1c(F)cc(F)cc1F.
What is the InChIKey of (E)-6-(2,4,6-trifluorophenyl)hex-5-enal?
The InChIKey is CGHIDYMDGRVWNI-HWKANZROSA-N. The full InChI is InChI=1S/C12H11F3O/c13-9-7-11(14)10(12(15)8-9)5-3-1-2-4-6-16/h3,5-8H,1-2,4H2/b5-3+.
What are the key properties of (E)-6-(2,4,6-trifluorophenyl)hex-5-enal?
(E)-6-(2,4,6-trifluorophenyl)hex-5-enal has a molecular weight of 228.21 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-(2,4,6-trifluorophenyl)hex-5-enal is sourced from PubChem (CID 87065924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).