C20H25N3O4S — CID 87066095
5-[1-(8-methoxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-2-piperidin-4-ylethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 87066095) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 5-[1-(8-methoxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-2-piperidin-4-ylethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[1-(8-methoxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-2-piperidin-4-ylethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87066095 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-[1-(8-methoxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-2-piperidin-4-ylethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C(CC2CCNCC2)C2SC(=O)NC2=O)c2c1NC(=O)CC2 |
| InChI | InChI=1S/C20H25N3O4S/c1-27-15-4-2-12(13-3-5-16(24)22-17(13)15)14(10-11-6-8-21-9-7-11)18-19(25)23-20(26)28-18/h2,4,11,14,18,21H,3,5-10H2,1H3,(H,22,24)(H,23,25,26) |
| InChIKey | WDPAFHHSLSRXBO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|