C14H29O5P — CID 87066118
(5,6-dihydroxy-4-oxohexyl)-(2,4,4-trimethylpentyl)phosphinic acid (PubChem CID 87066118) has the molecular formula C14H29O5P and a molecular weight of 308.36 g/mol. Its IUPAC name is (5,6-dihydroxy-4-oxohexyl)-(2,4,4-trimethylpentyl)phosphinic acid.
| Compound Name | (5,6-dihydroxy-4-oxohexyl)-(2,4,4-trimethylpentyl)phosphinic acid |
|---|---|
| PubChem CID | 87066118 |
| Molecular Formula | C14H29O5P |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (5,6-dihydroxy-4-oxohexyl)-(2,4,4-trimethylpentyl)phosphinic acid |
| SMILES | CC(CC(C)(C)C)CP(=O)(O)CCCC(=O)C(O)CO |
| InChI | InChI=1S/C14H29O5P/c1-11(8-14(2,3)4)10-20(18,19)7-5-6-12(16)13(17)9-15/h11,13,15,17H,5-10H2,1-4H3,(H,18,19) |
| InChIKey | NRHBMAUDPXFECP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|