C33H36N3O5+ — CID 87066144
[(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 87066144) has the molecular formula C33H36N3O5+ and a molecular weight of 554.67 g/mol. Its IUPAC name is [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87066144 |
| Molecular Formula | C33H36N3O5+ |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)Nc3ccc(CCCC(=O)Nc4ccc(C=O)cc4)cc3-c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C33H35N3O5/c1-36(2)28-18-25(19-29(36)32-31(28)41-32)40-33(39)35-27-16-13-21(17-26(27)23-8-4-3-5-9-23)7-6-10-30(38)34-24-14-11-22(20-37)12-15-24/h3-5,8-9,11-17,20,25,28-29,31-32H,6-7,10,18-19H2,1-2H3,(H-,34,35,37,38,39)/p+1/t25?,28-,29+,31-,32+ |
| InChIKey | JXBPOZQOJAASCQ-AKXOHCPJSA-O |
| XLogP | 5.43 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|