C13H8N2O5S-2 — CID 8706619
4-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]benzoate (PubChem CID 8706619) has the molecular formula C13H8N2O5S-2 and a molecular weight of 304.28 g/mol. Its IUPAC name is 4-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]benzoate.
| Compound Name | 4-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 8706619 |
| Molecular Formula | C13H8N2O5S-2 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]benzoate |
| SMILES | Cc1nnc(S/C(=C\c2ccc(C(=O)[O-])cc2)C(=O)[O-])o1 |
| InChI | InChI=1S/C13H10N2O5S/c1-7-14-15-13(20-7)21-10(12(18)19)6-8-2-4-9(5-3-8)11(16)17/h2-6H,1H3,(H,16,17)(H,18,19)/p-2/b10-6- |
| InChIKey | CXMJJKWMCHNDQH-POHAHGRESA-L |
| XLogP | -0.38 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|