C22H24O3 — CID 87066774
2-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-2,3-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 87066774) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-2,3-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | 2-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-2,3-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 87066774 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-2,3-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | CC(C)=C/C(C)=C\C1(C)OC2=C(CC1C)C(=O)C(=O)c1ccccc12 |
| InChI | InChI=1S/C22H24O3/c1-13(2)10-14(3)12-22(5)15(4)11-18-20(24)19(23)16-8-6-7-9-17(16)21(18)25-22/h6-10,12,15H,11H2,1-5H3/b14-12- |
| InChIKey | SMMFQMIQAWQMRC-OWBHPGMISA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|