About butanedioate;bis(triphenylsulfanium)
butanedioate;bis(triphenylsulfanium) (PubChem CID 87066795) has the molecular formula C40H34O4S2
and a molecular weight of 642.84 g/mol. Its IUPAC name is butanedioate;bis(triphenylsulfanium).
Molecular Properties
| Compound Name | butanedioate;bis(triphenylsulfanium) |
| PubChem CID | 87066795 |
| Molecular Formula | C40H34O4S2 |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | butanedioate;bis(triphenylsulfanium) |
| SMILES | O=C([O-])CCC(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15S.C4H6O4/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-3(6)1-2-4(7)8/h2*1-15H;1-2H2,(H,5,6)(H,7,8)/q2*+1;/p-2 |
| InChIKey | DJPMEIFWZZVEPI-UHFFFAOYSA-L |
| XLogP | 6.83 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze butanedioate;bis(triphenylsulfanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioate;bis(triphenylsulfanium)?
The IUPAC name of butanedioate;bis(triphenylsulfanium) (CID 87066795) is butanedioate;bis(triphenylsulfanium).
What is the SMILES notation for butanedioate;bis(triphenylsulfanium)?
The canonical SMILES for butanedioate;bis(triphenylsulfanium) is O=C([O-])CCC(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of butanedioate;bis(triphenylsulfanium)?
The InChIKey is DJPMEIFWZZVEPI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H15S.C4H6O4/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-3(6)1-2-4(7)8/h2*1-15H;1-2H2,(H,5,6)(H,7,8)/q2*+1;/p-2.
What are the key properties of butanedioate;bis(triphenylsulfanium)?
butanedioate;bis(triphenylsulfanium) has a molecular weight of 642.84 g/mol, XLogP of 6.83, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioate;bis(triphenylsulfanium) is sourced from PubChem (CID 87066795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).