C17H20F6N2O — CID 87066848
2-[4-(1,4-diazepan-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87066848) has the molecular formula C17H20F6N2O and a molecular weight of 382.35 g/mol. Its IUPAC name is 2-[4-(1,4-diazepan-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(1,4-diazepan-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87066848 |
| Molecular Formula | C17H20F6N2O |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[4-(1,4-diazepan-1-yl)-3-prop-1-enylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC=Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N1CCCNCC1 |
| InChI | InChI=1S/C17H20F6N2O/c1-2-4-12-11-13(15(26,16(18,19)20)17(21,22)23)5-6-14(12)25-9-3-7-24-8-10-25/h2,4-6,11,24,26H,3,7-10H2,1H3 |
| InChIKey | SPTIBTNQNCUMOK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|