About 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine
2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 87066894) has the molecular formula C11H31NO3Si3
and a molecular weight of 309.63 g/mol. Its IUPAC name is 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine.
Molecular Properties
| Compound Name | 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine |
| PubChem CID | 87066894 |
| Molecular Formula | C11H31NO3Si3 |
| Molecular Weight | 309.63 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | CO[Si](CCN([Si](C)(C)C)[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C11H31NO3Si3/c1-13-18(14-2,15-3)11-10-12(16(4,5)6)17(7,8)9/h10-11H2,1-9H3 |
| InChIKey | RHAYEZASBOVCGH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
The IUPAC name of 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine (CID 87066894) is 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine.
What is the SMILES notation for 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
The canonical SMILES for 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine is CO[Si](CCN([Si](C)(C)C)[Si](C)(C)C)(OC)OC.
What is the InChIKey of 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
The InChIKey is RHAYEZASBOVCGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H31NO3Si3/c1-13-18(14-2,15-3)11-10-12(16(4,5)6)17(7,8)9/h10-11H2,1-9H3.
What are the key properties of 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine?
2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine has a molecular weight of 309.63 g/mol, XLogP of 2.84, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethoxysilyl-N,N-bis(trimethylsilyl)ethanamine is sourced from PubChem (CID 87066894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).