C9H18O2 — CID 87066906
3-hydroxy-2,5-dimethylheptan-4-one (PubChem CID 87066906) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-hydroxy-2,5-dimethylheptan-4-one.
| Compound Name | 3-hydroxy-2,5-dimethylheptan-4-one |
|---|---|
| PubChem CID | 87066906 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 3-hydroxy-2,5-dimethylheptan-4-one |
| SMILES | CCC(C)C(=O)C(O)C(C)C |
| InChI | InChI=1S/C9H18O2/c1-5-7(4)9(11)8(10)6(2)3/h6-8,10H,5H2,1-4H3 |
| InChIKey | BUWSXIKGUMIUED-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |