About Hexanedioic acid, sodium salt (1:)
Hexanedioic acid, sodium salt (1:) (PubChem CID 87066922) has the molecular formula C6H10NaO4
and a molecular weight of 169.13 g/mol.
Molecular Properties
| Compound Name | Hexanedioic acid, sodium salt (1:) |
| PubChem CID | 87066922 |
| Molecular Formula | C6H10NaO4 |
| Molecular Weight | 169.13 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | — |
| SMILES | O=C(O)CCCCC(=O)O.[Na] |
| InChI | InChI=1S/C6H10O4.Na/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10); |
| InChIKey | JNWGMESTOMYLND-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.13 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Hexanedioic acid, sodium salt (1:) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hexanedioic acid, sodium salt (1:)?
The IUPAC name of Hexanedioic acid, sodium salt (1:) (CID 87066922) is not available.
What is the SMILES notation for Hexanedioic acid, sodium salt (1:)?
The canonical SMILES for Hexanedioic acid, sodium salt (1:) is O=C(O)CCCCC(=O)O.[Na].
What is the InChIKey of Hexanedioic acid, sodium salt (1:)?
The InChIKey is JNWGMESTOMYLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.Na/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);.
What are the key properties of Hexanedioic acid, sodium salt (1:)?
Hexanedioic acid, sodium salt (1:) has a molecular weight of 169.13 g/mol, XLogP of 0.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Hexanedioic acid, sodium salt (1:) is sourced from PubChem (CID 87066922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).