About pentanoate;triphenylsulfanium
pentanoate;triphenylsulfanium (PubChem CID 87067056) has the molecular formula C23H24O2S
and a molecular weight of 364.51 g/mol. Its IUPAC name is pentanoate;triphenylsulfanium.
Molecular Properties
| Compound Name | pentanoate;triphenylsulfanium |
| PubChem CID | 87067056 |
| Molecular Formula | C23H24O2S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | pentanoate;triphenylsulfanium |
| SMILES | CCCCC(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C5H10O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5(6)7/h1-15H;2-4H2,1H3,(H,6,7)/q+1;/p-1 |
| InChIKey | GJCRJMBIFRXQQQ-UHFFFAOYSA-M |
| XLogP | 4.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze pentanoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoate;triphenylsulfanium?
The IUPAC name of pentanoate;triphenylsulfanium (CID 87067056) is pentanoate;triphenylsulfanium.
What is the SMILES notation for pentanoate;triphenylsulfanium?
The canonical SMILES for pentanoate;triphenylsulfanium is CCCCC(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of pentanoate;triphenylsulfanium?
The InChIKey is GJCRJMBIFRXQQQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C5H10O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5(6)7/h1-15H;2-4H2,1H3,(H,6,7)/q+1;/p-1.
What are the key properties of pentanoate;triphenylsulfanium?
pentanoate;triphenylsulfanium has a molecular weight of 364.51 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoate;triphenylsulfanium is sourced from PubChem (CID 87067056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).