C10H13BrN2O3 — CID 87067233
(6-bromo-2-pyridinyl)methyl-(2-methoxyethyl)carbamic acid (PubChem CID 87067233) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is (6-bromo-2-pyridinyl)methyl-(2-methoxyethyl)carbamic acid.
| Compound Name | (6-bromo-2-pyridinyl)methyl-(2-methoxyethyl)carbamic acid |
|---|---|
| PubChem CID | 87067233 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (6-bromo-2-pyridinyl)methyl-(2-methoxyethyl)carbamic acid |
| SMILES | COCCN(Cc1cccc(Br)n1)C(=O)O |
| InChI | InChI=1S/C10H13BrN2O3/c1-16-6-5-13(10(14)15)7-8-3-2-4-9(11)12-8/h2-4H,5-7H2,1H3,(H,14,15) |
| InChIKey | NDRMNAFUWCAOLO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|