About 4-(ethylamino)butyl 2-methylprop-2-enoate
4-(ethylamino)butyl 2-methylprop-2-enoate (PubChem CID 87067321) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-(ethylamino)butyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 4-(ethylamino)butyl 2-methylprop-2-enoate |
| PubChem CID | 87067321 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-(ethylamino)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCNCC |
| InChI | InChI=1S/C10H19NO2/c1-4-11-7-5-6-8-13-10(12)9(2)3/h11H,2,4-8H2,1,3H3 |
| InChIKey | VORYQFSABDYCRB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylamino)butyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)butyl 2-methylprop-2-enoate?
The IUPAC name of 4-(ethylamino)butyl 2-methylprop-2-enoate (CID 87067321) is 4-(ethylamino)butyl 2-methylprop-2-enoate.
What is the SMILES notation for 4-(ethylamino)butyl 2-methylprop-2-enoate?
The canonical SMILES for 4-(ethylamino)butyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCCNCC.
What is the InChIKey of 4-(ethylamino)butyl 2-methylprop-2-enoate?
The InChIKey is VORYQFSABDYCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-4-11-7-5-6-8-13-10(12)9(2)3/h11H,2,4-8H2,1,3H3.
What are the key properties of 4-(ethylamino)butyl 2-methylprop-2-enoate?
4-(ethylamino)butyl 2-methylprop-2-enoate has a molecular weight of 185.27 g/mol, XLogP of 1.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)butyl 2-methylprop-2-enoate is sourced from PubChem (CID 87067321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).