C9H19NO2 — CID 87067420
1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium (PubChem CID 87067420) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 87067420 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
| SMILES | CC1(C)CCCC(C)(C)[N+]1([O-])O |
| InChI | InChI=1S/C9H19NO2/c1-8(2)6-5-7-9(3,4)10(8,11)12/h11H,5-7H2,1-4H3 |
| InChIKey | UHVHCDKGRUZQBG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|