C26H32N6O2 — CID 87067703
2-(3,5-dimethylpyrazol-1-yl)-2-[4-[2-(6-morpholin-4-yl-3-pyridinyl)phenyl]piperazin-1-yl]acetaldehyde (PubChem CID 87067703) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-2-[4-[2-(6-morpholin-4-yl-3-pyridinyl)phenyl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-2-[4-[2-(6-morpholin-4-yl-3-pyridinyl)phenyl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87067703 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-2-[4-[2-(6-morpholin-4-yl-3-pyridinyl)phenyl]piperazin-1-yl]acetaldehyde |
| SMILES | Cc1cc(C)n(C(C=O)N2CCN(c3ccccc3-c3ccc(N4CCOCC4)nc3)CC2)n1 |
| InChI | InChI=1S/C26H32N6O2/c1-20-17-21(2)32(28-20)26(19-33)31-11-9-29(10-12-31)24-6-4-3-5-23(24)22-7-8-25(27-18-22)30-13-15-34-16-14-30/h3-8,17-19,26H,9-16H2,1-2H3 |
| InChIKey | HLRUBYMOZKGWBO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|