C10H17F4NO2S — CID 87067713
1-(3,3,4,4-tetrafluoropentylsulfonyl)piperidine (PubChem CID 87067713) has the molecular formula C10H17F4NO2S and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(3,3,4,4-tetrafluoropentylsulfonyl)piperidine.
| Compound Name | 1-(3,3,4,4-tetrafluoropentylsulfonyl)piperidine |
|---|---|
| PubChem CID | 87067713 |
| Molecular Formula | C10H17F4NO2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(3,3,4,4-tetrafluoropentylsulfonyl)piperidine |
| SMILES | CC(F)(F)C(F)(F)CCS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C10H17F4NO2S/c1-9(11,12)10(13,14)5-8-18(16,17)15-6-3-2-4-7-15/h2-8H2,1H3 |
| InChIKey | XIXDQUJFFBZTOK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|