About prop-2-enyl 5-methyl-2-oxohexanoate
prop-2-enyl 5-methyl-2-oxohexanoate (PubChem CID 87067718) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-2-oxohexanoate.
Molecular Properties
| Compound Name | prop-2-enyl 5-methyl-2-oxohexanoate |
| PubChem CID | 87067718 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | prop-2-enyl 5-methyl-2-oxohexanoate |
| SMILES | C=CCOC(=O)C(=O)CCC(C)C |
| InChI | InChI=1S/C10H16O3/c1-4-7-13-10(12)9(11)6-5-8(2)3/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | LRCMXYYDSRXXES-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 5-methyl-2-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 5-methyl-2-oxohexanoate?
The IUPAC name of prop-2-enyl 5-methyl-2-oxohexanoate (CID 87067718) is prop-2-enyl 5-methyl-2-oxohexanoate.
What is the SMILES notation for prop-2-enyl 5-methyl-2-oxohexanoate?
The canonical SMILES for prop-2-enyl 5-methyl-2-oxohexanoate is C=CCOC(=O)C(=O)CCC(C)C.
What is the InChIKey of prop-2-enyl 5-methyl-2-oxohexanoate?
The InChIKey is LRCMXYYDSRXXES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-4-7-13-10(12)9(11)6-5-8(2)3/h4,8H,1,5-7H2,2-3H3.
What are the key properties of prop-2-enyl 5-methyl-2-oxohexanoate?
prop-2-enyl 5-methyl-2-oxohexanoate has a molecular weight of 184.23 g/mol, XLogP of 1.72, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 5-methyl-2-oxohexanoate is sourced from PubChem (CID 87067718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).