C8H16O6S4 — CID 87068897
[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]tetrasulfanyl] propanoate (PubChem CID 87068897) has the molecular formula C8H16O6S4 and a molecular weight of 336.48 g/mol. Its IUPAC name is [[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]tetrasulfanyl] propanoate.
| Compound Name | [[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]tetrasulfanyl] propanoate |
|---|---|
| PubChem CID | 87068897 |
| Molecular Formula | C8H16O6S4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | [[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]tetrasulfanyl] propanoate |
| SMILES | CCC(=O)OSSSSOCC(CO)(CO)CO |
| InChI | InChI=1S/C8H16O6S4/c1-2-7(12)14-16-18-17-15-13-6-8(3-9,4-10)5-11/h9-11H,2-6H2,1H3 |
| InChIKey | KFPVWZIIPFDLMX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|