About 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid
2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid (PubChem CID 87068938) has the molecular formula C16H20N2O3S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid |
| PubChem CID | 87068938 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[H]/N=C(\N)c1ccc(C)cc1C |
| InChI | InChI=1S/C9H12N2.C7H8O3S/c1-6-3-4-8(9(10)11)7(2)5-6;1-6-2-4-7(5-3-6)11(8,9)10/h3-5H,1-2H3,(H3,10,11);2-5H,1H3,(H,8,9,10) |
| InChIKey | XEHZXULICFVMGG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid?
The IUPAC name of 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid (CID 87068938) is 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid.
What is the SMILES notation for 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid?
The canonical SMILES for 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.[H]/N=C(\N)c1ccc(C)cc1C.
What is the InChIKey of 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid?
The InChIKey is XEHZXULICFVMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C7H8O3S/c1-6-3-4-8(9(10)11)7(2)5-6;1-6-2-4-7(5-3-6)11(8,9)10/h3-5H,1-2H3,(H3,10,11);2-5H,1H3,(H,8,9,10).
What are the key properties of 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid?
2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid has a molecular weight of 320.41 g/mol, XLogP of 2.83, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylbenzenecarboximidamide;4-methylbenzenesulfonic acid is sourced from PubChem (CID 87068938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).