About tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone
tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone (PubChem CID 87069101) has the molecular formula C16H36O2Si2
and a molecular weight of 316.63 g/mol. Its IUPAC name is tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone.
Molecular Properties
| Compound Name | tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone |
| PubChem CID | 87069101 |
| Molecular Formula | C16H36O2Si2 |
| Molecular Weight | 316.63 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone |
| SMILES | C=C=O.CC[Si](C)(O[Si](C)(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H34OSi2.C2H2O/c1-11-16(9,13(3,4)5)15-17(10,12-2)14(6,7)8;1-2-3/h11-12H2,1-10H3;1H2 |
| InChIKey | UEDQTMODLFFZAY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone?
The IUPAC name of tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone (CID 87069101) is tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone.
What is the SMILES notation for tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone?
The canonical SMILES for tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone is C=C=O.CC[Si](C)(O[Si](C)(CC)C(C)(C)C)C(C)(C)C.
What is the InChIKey of tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone?
The InChIKey is UEDQTMODLFFZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H34OSi2.C2H2O/c1-11-16(9,13(3,4)5)15-17(10,12-2)14(6,7)8;1-2-3/h11-12H2,1-10H3;1H2.
What are the key properties of tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone?
tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone has a molecular weight of 316.63 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(tert-butyl-ethyl-methylsilyl)oxy-ethyl-methylsilane;ethenone is sourced from PubChem (CID 87069101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).