About (E)-3-amino-N,2-diethylpent-2-enamide
(E)-3-amino-N,2-diethylpent-2-enamide (PubChem CID 87069257) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is (E)-3-amino-N,2-diethylpent-2-enamide.
Molecular Properties
| Compound Name | (E)-3-amino-N,2-diethylpent-2-enamide |
| PubChem CID | 87069257 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (E)-3-amino-N,2-diethylpent-2-enamide |
| SMILES | CCNC(=O)/C(CC)=C(/N)CC |
| InChI | InChI=1S/C9H18N2O/c1-4-7(8(10)5-2)9(12)11-6-3/h4-6,10H2,1-3H3,(H,11,12)/b8-7+ |
| InChIKey | RXQKKCDIEVDELG-BQYQJAHWSA-N |
| XLogP | 1.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-N,2-diethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-N,2-diethylpent-2-enamide?
The IUPAC name of (E)-3-amino-N,2-diethylpent-2-enamide (CID 87069257) is (E)-3-amino-N,2-diethylpent-2-enamide.
What is the SMILES notation for (E)-3-amino-N,2-diethylpent-2-enamide?
The canonical SMILES for (E)-3-amino-N,2-diethylpent-2-enamide is CCNC(=O)/C(CC)=C(/N)CC.
What is the InChIKey of (E)-3-amino-N,2-diethylpent-2-enamide?
The InChIKey is RXQKKCDIEVDELG-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H18N2O/c1-4-7(8(10)5-2)9(12)11-6-3/h4-6,10H2,1-3H3,(H,11,12)/b8-7+.
What are the key properties of (E)-3-amino-N,2-diethylpent-2-enamide?
(E)-3-amino-N,2-diethylpent-2-enamide has a molecular weight of 170.26 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-N,2-diethylpent-2-enamide is sourced from PubChem (CID 87069257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).